About 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine
6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine (PubChem CID 173333590) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine |
| PubChem CID | 173333590 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine |
| SMILES | CCN(CC)CCCCCCOC1=CCCC=C1 |
| InChI | InChI=1S/C16H29NO/c1-3-17(4-2)14-10-5-6-11-15-18-16-12-8-7-9-13-16/h8,12-13H,3-7,9-11,14-15H2,1-2H3 |
| InChIKey | YAWOAJSGMOKGJY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine?
The IUPAC name of 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine (CID 173333590) is 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine.
What is the SMILES notation for 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine?
The canonical SMILES for 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine is CCN(CC)CCCCCCOC1=CCCC=C1.
What is the InChIKey of 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine?
The InChIKey is YAWOAJSGMOKGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO/c1-3-17(4-2)14-10-5-6-11-15-18-16-12-8-7-9-13-16/h8,12-13H,3-7,9-11,14-15H2,1-2H3.
What are the key properties of 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine?
6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine has a molecular weight of 251.41 g/mol, XLogP of 4.14, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-1,5-dien-1-yloxy-N,N-diethylhexan-1-amine is sourced from PubChem (CID 173333590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).