C33H29F3N4Na2O6 — CID 173334100
disodium;3-[18-(2-carboxylatoethyl)-8-(hydroxymethylidene)-3,7,12,17-tetramethyl-13-(2,2,2-trifluoro-1-hydroxyethyl)-22H-porphyrin-2-yl]propanoate (PubChem CID 173334100) has the molecular formula C33H29F3N4Na2O6 and a molecular weight of 680.59 g/mol. Its IUPAC name is disodium;3-[18-(2-carboxylatoethyl)-8-(hydroxymethylidene)-3,7,12,17-tetramethyl-13-(2,2,2-trifluoro-1-hydroxyethyl)-22H-porphyrin-2-yl]propanoate.
| Compound Name | disodium;3-[18-(2-carboxylatoethyl)-8-(hydroxymethylidene)-3,7,12,17-tetramethyl-13-(2,2,2-trifluoro-1-hydroxyethyl)-22H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 173334100 |
| Molecular Formula | C33H29F3N4Na2O6 |
| Molecular Weight | 680.59 g/mol |
| Exact Mass | 680.18 |
| IUPAC Name | disodium;3-[18-(2-carboxylatoethyl)-8-(hydroxymethylidene)-3,7,12,17-tetramethyl-13-(2,2,2-trifluoro-1-hydroxyethyl)-22H-porphyrin-2-yl]propanoate |
| SMILES | CC1=C(CCC(=O)[O-])/C2=C/C3=N/C(=C\c4[nH]/c(c(=CO)c4C)=C\C4=N/C(=C\C1=N2)C(C(O)C(F)(F)F)=C4C)C(C)=C3CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C33H31F3N4O6.2Na/c1-14-18(5-7-29(42)43)25-12-26-19(6-8-30(44)45)15(2)23(38-26)11-28-31(32(46)33(34,35)36)17(4)24(40-28)10-27-20(13-41)16(3)22(39-27)9-21(14)37-25;;/h9-13,32,39,41,46H,5-8H2,1-4H3,(H,42,43)(H,44,45);;/q;2*+1/p-2/b20-13?,21-9-,26-12-,27-10-,28-11-;; |
| InChIKey | XJHLGMYDWIRRHY-MQLPSFQYSA-L |
| XLogP | -4.17 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.59 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |