C20H29FN2O — CID 173334127
(2S)-3-[[(6R)-2-[(4-fluorophenyl)methylidene]-6-methylcyclohexylidene]amino]oxy-N,N,2-trimethylpropan-1-amine (PubChem CID 173334127) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is (2S)-3-[[(6R)-2-[(4-fluorophenyl)methylidene]-6-methylcyclohexylidene]amino]oxy-N,N,2-trimethylpropan-1-amine.
| Compound Name | (2S)-3-[[(6R)-2-[(4-fluorophenyl)methylidene]-6-methylcyclohexylidene]amino]oxy-N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 173334127 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (2S)-3-[[(6R)-2-[(4-fluorophenyl)methylidene]-6-methylcyclohexylidene]amino]oxy-N,N,2-trimethylpropan-1-amine |
| SMILES | C[C@H](CON=C1C(=Cc2ccc(F)cc2)CCC[C@H]1C)CN(C)C |
| InChI | InChI=1S/C20H29FN2O/c1-15(13-23(3)4)14-24-22-20-16(2)6-5-7-18(20)12-17-8-10-19(21)11-9-17/h8-12,15-16H,5-7,13-14H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | FLVUSZYTRHTHQM-JKSUJKDBSA-N |
| XLogP | 4.60 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|