About 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile
5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile (PubChem CID 173334557) has the molecular formula C8H6N3S+
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile.
Molecular Properties
| Compound Name | 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile |
| PubChem CID | 173334557 |
| Molecular Formula | C8H6N3S+ |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile |
| SMILES | Cc1cc2csnc2[nH+]c1C#N |
| InChI | InChI=1S/C8H5N3S/c1-5-2-6-4-12-11-8(6)10-7(5)3-9/h2,4H,1H3/p+1 |
| InChIKey | QYXIYCSMMILEFJ-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile?
The IUPAC name of 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile (CID 173334557) is 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile.
What is the SMILES notation for 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile?
The canonical SMILES for 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile is Cc1cc2csnc2[nH+]c1C#N.
What is the InChIKey of 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile?
The InChIKey is QYXIYCSMMILEFJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H5N3S/c1-5-2-6-4-12-11-8(6)10-7(5)3-9/h2,4H,1H3/p+1.
What are the key properties of 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile?
5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile has a molecular weight of 176.22 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-[1,2]thiazolo[3,4-b]pyridin-7-ium-6-carbonitrile is sourced from PubChem (CID 173334557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).