C14H28N4O8 — CID 173334634
azane;2-[3,3-diamino-1,2,2-tris(carboxymethyl)cyclohexyl]acetic acid (PubChem CID 173334634) has the molecular formula C14H28N4O8 and a molecular weight of 380.40 g/mol. Its IUPAC name is azane;2-[3,3-diamino-1,2,2-tris(carboxymethyl)cyclohexyl]acetic acid.
| Compound Name | azane;2-[3,3-diamino-1,2,2-tris(carboxymethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 173334634 |
| Molecular Formula | C14H28N4O8 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | azane;2-[3,3-diamino-1,2,2-tris(carboxymethyl)cyclohexyl]acetic acid |
| SMILES | N.N.NC1(N)CCCC(CC(=O)O)(CC(=O)O)C1(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H22N2O8.2H3N/c15-14(16)3-1-2-12(4-8(17)18,5-9(19)20)13(14,6-10(21)22)7-11(23)24;;/h1-7,15-16H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);2*1H3 |
| InChIKey | DLENMWSAYNPKNX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 271.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|