C41H40N4O — CID 173334985
1-[17,17,20-trimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol (PubChem CID 173334985) has the molecular formula C41H40N4O and a molecular weight of 604.80 g/mol. Its IUPAC name is 1-[17,17,20-trimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol.
| Compound Name | 1-[17,17,20-trimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 173334985 |
| Molecular Formula | C41H40N4O |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | 1-[17,17,20-trimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
| SMILES | CC(O)=C1C=C2N=C1/C(C)=C1/CC(C)(C)/C(=C/C3=N/C(=C(/c4ccc(C)cc4)C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C=C3)N1 |
| InChI | InChI=1S/C41H40N4O/c1-22-9-11-28(12-10-22)38-31-14-13-29(42-31)19-36-41(7,8)21-35(44-36)26(5)40-30(27(6)46)20-34(45-40)39(33-16-15-32(38)43-33)37-24(3)17-23(2)18-25(37)4/h9-20,44,46H,21H2,1-8H3/b30-27?,35-26-,36-19-,38-31-,39-33+ |
| InChIKey | YAOZHXMETPSJIA-NVHZDMAYSA-N |
| XLogP | 9.43 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|