About N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride
N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride (PubChem CID 17333555) has the molecular formula C17H27Cl2N
and a molecular weight of 316.32 g/mol. Its IUPAC name is N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride |
| PubChem CID | 17333555 |
| Molecular Formula | C17H27Cl2N |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride |
| SMILES | CC(C)(C)CC(C)(C)NC/C=C/c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H26ClN.ClH/c1-16(2,3)13-17(4,5)19-12-6-7-14-8-10-15(18)11-9-14;/h6-11,19H,12-13H2,1-5H3;1H/b7-6+; |
| InChIKey | OMTIBTXSRKPAIQ-UHDJGPCESA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride?
The IUPAC name of N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride (CID 17333555) is N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride.
What is the SMILES notation for N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride?
The canonical SMILES for N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride is CC(C)(C)CC(C)(C)NC/C=C/c1ccc(Cl)cc1.Cl.
What is the InChIKey of N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride?
The InChIKey is OMTIBTXSRKPAIQ-UHDJGPCESA-N. The full InChI is InChI=1S/C17H26ClN.ClH/c1-16(2,3)13-17(4,5)19-12-6-7-14-8-10-15(18)11-9-14;/h6-11,19H,12-13H2,1-5H3;1H/b7-6+;.
What are the key properties of N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride?
N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride has a molecular weight of 316.32 g/mol, XLogP of 5.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-(4-chlorophenyl)prop-2-enyl]-2,4,4-trimethylpentan-2-amine;hydrochloride is sourced from PubChem (CID 17333555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).