About 2,3,4-trimethyloxonin-1-ium tetrafluoroborate
2,3,4-trimethyloxonin-1-ium tetrafluoroborate (PubChem CID 173335779) has the molecular formula C11H15BF4O
and a molecular weight of 250.04 g/mol. Its IUPAC name is 2,3,4-trimethyloxonin-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 2,3,4-trimethyloxonin-1-ium tetrafluoroborate |
| PubChem CID | 173335779 |
| Molecular Formula | C11H15BF4O |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2,3,4-trimethyloxonin-1-ium tetrafluoroborate |
| SMILES | Cc1ccccc[oH+]c(C)c1C.F[B-](F)(F)F |
| InChI | InChI=1S/C11H14O.BF4/c1-9-7-5-4-6-8-12-11(3)10(9)2;2-1(3,4)5/h4-8H,1-3H3;/q;-1/p+1 |
| InChIKey | WGAQNQIDHOBBAB-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 12.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trimethyloxonin-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethyloxonin-1-ium tetrafluoroborate?
The IUPAC name of 2,3,4-trimethyloxonin-1-ium tetrafluoroborate (CID 173335779) is 2,3,4-trimethyloxonin-1-ium tetrafluoroborate.
What is the SMILES notation for 2,3,4-trimethyloxonin-1-ium tetrafluoroborate?
The canonical SMILES for 2,3,4-trimethyloxonin-1-ium tetrafluoroborate is Cc1ccccc[oH+]c(C)c1C.F[B-](F)(F)F.
What is the InChIKey of 2,3,4-trimethyloxonin-1-ium tetrafluoroborate?
The InChIKey is WGAQNQIDHOBBAB-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H14O.BF4/c1-9-7-5-4-6-8-12-11(3)10(9)2;2-1(3,4)5/h4-8H,1-3H3;/q;-1/p+1.
What are the key properties of 2,3,4-trimethyloxonin-1-ium tetrafluoroborate?
2,3,4-trimethyloxonin-1-ium tetrafluoroborate has a molecular weight of 250.04 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethyloxonin-1-ium tetrafluoroborate is sourced from PubChem (CID 173335779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).