About phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate
phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate (PubChem CID 173335906) has the molecular formula C21H14Cl2FNO3S
and a molecular weight of 450.32 g/mol. Its IUPAC name is phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate.
Molecular Properties
| Compound Name | phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate |
| PubChem CID | 173335906 |
| Molecular Formula | C21H14Cl2FNO3S |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate |
| SMILES | COC=C(C=C(F)c1csc(-c2ccc(Cl)c(Cl)c2)n1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H14Cl2FNO3S/c1-27-11-14(21(26)28-15-5-3-2-4-6-15)10-18(24)19-12-29-20(25-19)13-7-8-16(22)17(23)9-13/h2-12H,1H3 |
| InChIKey | ISGFROTZMWQOEK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate?
The IUPAC name of phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate (CID 173335906) is phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate.
What is the SMILES notation for phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate?
The canonical SMILES for phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate is COC=C(C=C(F)c1csc(-c2ccc(Cl)c(Cl)c2)n1)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate?
The InChIKey is ISGFROTZMWQOEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl2FNO3S/c1-27-11-14(21(26)28-15-5-3-2-4-6-15)10-18(24)19-12-29-20(25-19)13-7-8-16(22)17(23)9-13/h2-12H,1H3.
What are the key properties of phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate?
phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate has a molecular weight of 450.32 g/mol, XLogP of 6.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-4-fluoro-2-(methoxymethylidene)but-3-enoate is sourced from PubChem (CID 173335906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).