C16H9NO2 — CID 173336202
7-azatetracyclo[11.3.1.05,16.09,14]heptadeca-1(17),2,4,9,11,13,15-heptaene-6,8-dione (PubChem CID 173336202) has the molecular formula C16H9NO2 and a molecular weight of 247.25 g/mol. Its IUPAC name is 7-azatetracyclo[11.3.1.05,16.09,14]heptadeca-1(17),2,4,9,11,13,15-heptaene-6,8-dione.
| Compound Name | 7-azatetracyclo[11.3.1.05,16.09,14]heptadeca-1(17),2,4,9,11,13,15-heptaene-6,8-dione |
|---|---|
| PubChem CID | 173336202 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 7-azatetracyclo[11.3.1.05,16.09,14]heptadeca-1(17),2,4,9,11,13,15-heptaene-6,8-dione |
| SMILES | O=c1[nH]c(=O)c2cccc3cc4cccc1c4cc32 |
| InChI | InChI=1S/C16H9NO2/c18-15-11-5-1-3-9-7-10-4-2-6-12(16(19)17-15)14(10)8-13(9)11/h1-8H,(H,17,18,19) |
| InChIKey | XHTGPHDCUMJJNL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|