About 1-(1H-indol-3-yl)-2,3-dihydroindazole
1-(1H-indol-3-yl)-2,3-dihydroindazole (PubChem CID 173336641) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2,3-dihydroindazole.
Molecular Properties
| Compound Name | 1-(1H-indol-3-yl)-2,3-dihydroindazole |
| PubChem CID | 173336641 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(1H-indol-3-yl)-2,3-dihydroindazole |
| SMILES | c1ccc2c(c1)CNN2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H13N3/c1-4-8-14-11(5-1)9-17-18(14)15-10-16-13-7-3-2-6-12(13)15/h1-8,10,16-17H,9H2 |
| InChIKey | IBDNNGUNVWLPSF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-indol-3-yl)-2,3-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indol-3-yl)-2,3-dihydroindazole?
The IUPAC name of 1-(1H-indol-3-yl)-2,3-dihydroindazole (CID 173336641) is 1-(1H-indol-3-yl)-2,3-dihydroindazole.
What is the SMILES notation for 1-(1H-indol-3-yl)-2,3-dihydroindazole?
The canonical SMILES for 1-(1H-indol-3-yl)-2,3-dihydroindazole is c1ccc2c(c1)CNN2c1c[nH]c2ccccc12.
What is the InChIKey of 1-(1H-indol-3-yl)-2,3-dihydroindazole?
The InChIKey is IBDNNGUNVWLPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c1-4-8-14-11(5-1)9-17-18(14)15-10-16-13-7-3-2-6-12(13)15/h1-8,10,16-17H,9H2.
What are the key properties of 1-(1H-indol-3-yl)-2,3-dihydroindazole?
1-(1H-indol-3-yl)-2,3-dihydroindazole has a molecular weight of 235.29 g/mol, XLogP of 3.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indol-3-yl)-2,3-dihydroindazole is sourced from PubChem (CID 173336641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).