About 2-(3-tert-butylphenyl)-1,3-diethylbenzene
2-(3-tert-butylphenyl)-1,3-diethylbenzene (PubChem CID 173336960) has the molecular formula C20H26
and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-1,3-diethylbenzene.
Molecular Properties
| Compound Name | 2-(3-tert-butylphenyl)-1,3-diethylbenzene |
| PubChem CID | 173336960 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-(3-tert-butylphenyl)-1,3-diethylbenzene |
| SMILES | CCc1cccc(CC)c1-c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H26/c1-6-15-10-8-11-16(7-2)19(15)17-12-9-13-18(14-17)20(3,4)5/h8-14H,6-7H2,1-5H3 |
| InChIKey | NEIBSRHXUQQXOC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(3-tert-butylphenyl)-1,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-tert-butylphenyl)-1,3-diethylbenzene?
The IUPAC name of 2-(3-tert-butylphenyl)-1,3-diethylbenzene (CID 173336960) is 2-(3-tert-butylphenyl)-1,3-diethylbenzene.
What is the SMILES notation for 2-(3-tert-butylphenyl)-1,3-diethylbenzene?
The canonical SMILES for 2-(3-tert-butylphenyl)-1,3-diethylbenzene is CCc1cccc(CC)c1-c1cccc(C(C)(C)C)c1.
What is the InChIKey of 2-(3-tert-butylphenyl)-1,3-diethylbenzene?
The InChIKey is NEIBSRHXUQQXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26/c1-6-15-10-8-11-16(7-2)19(15)17-12-9-13-18(14-17)20(3,4)5/h8-14H,6-7H2,1-5H3.
What are the key properties of 2-(3-tert-butylphenyl)-1,3-diethylbenzene?
2-(3-tert-butylphenyl)-1,3-diethylbenzene has a molecular weight of 266.43 g/mol, XLogP of 5.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tert-butylphenyl)-1,3-diethylbenzene is sourced from PubChem (CID 173336960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).