C6H12N3+ — CID 173337166
1,2,3,6-tetrahydropyridin-1-ium-1-carboximidamide (PubChem CID 173337166) has the molecular formula C6H12N3+ and a molecular weight of 126.18 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridin-1-ium-1-carboximidamide.
| Compound Name | 1,2,3,6-tetrahydropyridin-1-ium-1-carboximidamide |
|---|---|
| PubChem CID | 173337166 |
| Molecular Formula | C6H12N3+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 1,2,3,6-tetrahydropyridin-1-ium-1-carboximidamide |
| SMILES | [H]/N=C(\N)[NH+]1CC=CCC1 |
| InChI | InChI=1S/C6H11N3/c7-6(8)9-4-2-1-3-5-9/h1-2H,3-5H2,(H3,7,8)/p+1 |
| InChIKey | HIGHKFQTHJHNOS-UHFFFAOYSA-O |
| XLogP | -1.28 |
| TPSA | 54.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|