About [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane
[3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane (PubChem CID 173337346) has the molecular formula C10H16Cl2Si
and a molecular weight of 235.23 g/mol. Its IUPAC name is [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane.
Molecular Properties
| Compound Name | [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane |
| PubChem CID | 173337346 |
| Molecular Formula | C10H16Cl2Si |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane |
| SMILES | [SiH3]C(Cl)(Cl)CCC12C=CC(CC1)C2 |
| InChI | InChI=1S/C10H16Cl2Si/c11-10(12,13)6-5-9-3-1-8(7-9)2-4-9/h1,3,8H,2,4-7H2,13H3 |
| InChIKey | HGSBWVUOPZQWPP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane?
The IUPAC name of [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane (CID 173337346) is [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane.
What is the SMILES notation for [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane?
The canonical SMILES for [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane is [SiH3]C(Cl)(Cl)CCC12C=CC(CC1)C2.
What is the InChIKey of [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane?
The InChIKey is HGSBWVUOPZQWPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16Cl2Si/c11-10(12,13)6-5-9-3-1-8(7-9)2-4-9/h1,3,8H,2,4-7H2,13H3.
What are the key properties of [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane?
[3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane has a molecular weight of 235.23 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-bicyclo[2.2.1]hept-2-enyl)-1,1-dichloropropyl]silane is sourced from PubChem (CID 173337346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).