About 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide
3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide (PubChem CID 173338069) has the molecular formula C16H15N5OS
and a molecular weight of 325.40 g/mol. Its IUPAC name is 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide |
| PubChem CID | 173338069 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide |
| SMILES | CNc1ccc(Oc2ccccc2)nc1C(N)=Nc1nccs1 |
| InChI | InChI=1S/C16H15N5OS/c1-18-12-7-8-13(22-11-5-3-2-4-6-11)20-14(12)15(17)21-16-19-9-10-23-16/h2-10,18H,1H3,(H2,17,19,21) |
| InChIKey | YYWCSEWWYBDALW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide?
The IUPAC name of 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide (CID 173338069) is 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide.
What is the SMILES notation for 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide?
The canonical SMILES for 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide is CNc1ccc(Oc2ccccc2)nc1C(N)=Nc1nccs1.
What is the InChIKey of 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide?
The InChIKey is YYWCSEWWYBDALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5OS/c1-18-12-7-8-13(22-11-5-3-2-4-6-11)20-14(12)15(17)21-16-19-9-10-23-16/h2-10,18H,1H3,(H2,17,19,21).
What are the key properties of 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide?
3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide has a molecular weight of 325.40 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-6-phenoxy-N'-(1,3-thiazol-2-yl)pyridine-2-carboximidamide is sourced from PubChem (CID 173338069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).