About calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride
calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride (PubChem CID 173338216) has the molecular formula C7H13CaNO2
and a molecular weight of 183.26 g/mol. Its IUPAC name is calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride.
Molecular Properties
| Compound Name | calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride |
| PubChem CID | 173338216 |
| Molecular Formula | C7H13CaNO2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride |
| SMILES | CCC1(C)CC(=O)NC1=O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C7H11NO2.Ca.2H/c1-3-7(2)4-5(9)8-6(7)10;;;/h3-4H2,1-2H3,(H,8,9,10);;;/q;+2;2*-1 |
| InChIKey | WRMMGMFGFSYEEN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride?
The IUPAC name of calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride (CID 173338216) is calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride.
What is the SMILES notation for calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride?
The canonical SMILES for calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride is CCC1(C)CC(=O)NC1=O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride?
The InChIKey is WRMMGMFGFSYEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.Ca.2H/c1-3-7(2)4-5(9)8-6(7)10;;;/h3-4H2,1-2H3,(H,8,9,10);;;/q;+2;2*-1.
What are the key properties of calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride?
calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride has a molecular weight of 183.26 g/mol, XLogP of 0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;3-ethyl-3-methylpyrrolidine-2,5-dione;hydride is sourced from PubChem (CID 173338216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).