C16H18ClNO3 — CID 17333825
2-chloro-N-[2-(2,6-dioxocyclohexyl)propan-2-yl]benzamide (PubChem CID 17333825) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,6-dioxocyclohexyl)propan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[2-(2,6-dioxocyclohexyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 17333825 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-chloro-N-[2-(2,6-dioxocyclohexyl)propan-2-yl]benzamide |
| SMILES | CC(C)(NC(=O)c1ccccc1Cl)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C16H18ClNO3/c1-16(2,14-12(19)8-5-9-13(14)20)18-15(21)10-6-3-4-7-11(10)17/h3-4,6-7,14H,5,8-9H2,1-2H3,(H,18,21) |
| InChIKey | MHIMIDSXPOMSQE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|