C38H46P2 — CID 173338379
(R)-cyclohexyl-[cyclohexyl-[3-methyl-2-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]phosphanyl]-(4-phenylphenyl)phosphane (PubChem CID 173338379) has the molecular formula C38H46P2 and a molecular weight of 564.73 g/mol. Its IUPAC name is (R)-cyclohexyl-[cyclohexyl-[3-methyl-2-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]phosphanyl]-(4-phenylphenyl)phosphane.
| Compound Name | (R)-cyclohexyl-[cyclohexyl-[3-methyl-2-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]phosphanyl]-(4-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 173338379 |
| Molecular Formula | C38H46P2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | (R)-cyclohexyl-[cyclohexyl-[3-methyl-2-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]phosphanyl]-(4-phenylphenyl)phosphane |
| SMILES | CC1=C(c2ccccc2C)C([P@](C2CCCCC2)[P@@](c2ccc(-c3ccccc3)cc2)C2CCCCC2)CC=C1 |
| InChI | InChI=1S/C38H46P2/c1-29-15-12-13-23-36(29)38-30(2)16-14-24-37(38)40(34-21-10-5-11-22-34)39(33-19-8-4-9-20-33)35-27-25-32(26-28-35)31-17-6-3-7-18-31/h3,6-7,12-18,23,25-28,33-34,37H,4-5,8-11,19-22,24H2,1-2H3/t37?,39-,40+/m1/s1 |
| InChIKey | VYNYPWPVQXOHHY-RGVRLXPNSA-N |
| XLogP | 11.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|