C14H15N4NaO4S2 — CID 173338981
sodium;(3S,6R,10R)-4-formyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;hydride (PubChem CID 173338981) has the molecular formula C14H15N4NaO4S2 and a molecular weight of 390.42 g/mol. Its IUPAC name is sodium;(3S,6R,10R)-4-formyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;hydride.
| Compound Name | sodium;(3S,6R,10R)-4-formyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;hydride |
|---|---|
| PubChem CID | 173338981 |
| Molecular Formula | C14H15N4NaO4S2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | sodium;(3S,6R,10R)-4-formyl-8-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;hydride |
| SMILES | Cc1nnc(SCC2=C(C(=O)O)N3C(=O)[C@@H]4[C@H]3[C@H](C2)CN4C=O)s1.[H-].[Na+] |
| InChI | InChI=1S/C14H14N4O4S2.Na.H/c1-6-15-16-14(24-6)23-4-8-2-7-3-17(5-19)11-9(7)18(12(11)20)10(8)13(21)22;;/h5,7,9,11H,2-4H2,1H3,(H,21,22);;/q;+1;-1/t7-,9-,11+;;/m1../s1 |
| InChIKey | WSIGSRXJQHKFPB-FPJGZEBKSA-N |
| XLogP | -2.53 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|