C25H16N4O — CID 173339194
25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,5,7,9,11(27),12,14,16(26),17,19,21,23-tridecaen-4-ylidenemethanol (PubChem CID 173339194) has the molecular formula C25H16N4O and a molecular weight of 388.43 g/mol. Its IUPAC name is 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,5,7,9,11(27),12,14,16(26),17,19,21,23-tridecaen-4-ylidenemethanol.
| Compound Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,5,7,9,11(27),12,14,16(26),17,19,21,23-tridecaen-4-ylidenemethanol |
|---|---|
| PubChem CID | 173339194 |
| Molecular Formula | C25H16N4O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,5,7,9,11(27),12,14,16(26),17,19,21,23-tridecaen-4-ylidenemethanol |
| SMILES | OC=c1cc2[nH]/c1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)c2ccccc21 |
| InChI | InChI=1S/C25H16N4O/c30-14-15-9-20-11-18-6-5-16(26-18)10-17-7-8-19(27-17)12-24-21-3-1-2-4-22(21)25(29-24)13-23(15)28-20/h1-14,28,30H/b15-14?,17-10-,18-11-,23-13-,24-12- |
| InChIKey | RJVXQCKLKAJZJS-OQADQQICSA-N |
| XLogP | 3.19 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |