C30H39NO7 — CID 173339370
[(1S,2S,6R,10S,11S,13S,14R,15R)-1,6,13-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-(4-propylphenyl)carbamate (PubChem CID 173339370) has the molecular formula C30H39NO7 and a molecular weight of 525.64 g/mol. Its IUPAC name is [(1S,2S,6R,10S,11S,13S,14R,15R)-1,6,13-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-(4-propylphenyl)carbamate.
| Compound Name | [(1S,2S,6R,10S,11S,13S,14R,15R)-1,6,13-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-(4-propylphenyl)carbamate |
|---|---|
| PubChem CID | 173339370 |
| Molecular Formula | C30H39NO7 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [(1S,2S,6R,10S,11S,13S,14R,15R)-1,6,13-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-(4-propylphenyl)carbamate |
| SMILES | CCCc1ccc(NC(=O)O[C@@H]2[C@@H](C)[C@@]3(O)[C@@H](C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@@H]34)[C@H]3C(C)(C)[C@]23O)cc1 |
| InChI | InChI=1S/C30H39NO7/c1-6-7-18-8-10-20(11-9-18)31-26(34)38-25-17(3)29(36)21(23-27(4,5)30(23,25)37)13-19(15-32)14-28(35)22(29)12-16(2)24(28)33/h8-13,17,21-23,25,32,35-37H,6-7,14-15H2,1-5H3,(H,31,34)/t17-,21+,22-,23+,25-,28-,29-,30-/m1/s1 |
| InChIKey | SHHUFPQFUSSNIO-KZCWOULYSA-N |
| XLogP | 3.14 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|