About 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron
4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron (PubChem CID 173339522) has the molecular formula C6H7Cl2NO5S
and a molecular weight of 276.10 g/mol. Its IUPAC name is 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron.
Molecular Properties
| Compound Name | 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron |
| PubChem CID | 173339522 |
| Molecular Formula | C6H7Cl2NO5S |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron |
| SMILES | Nc1ccc(O)c(Cl)c1Cl.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C6H5Cl2NO.H2O4S/c7-5-3(9)1-2-4(10)6(5)8;1-5(2,3)4/h1-2,10H,9H2;(H2,1,2,3,4) |
| InChIKey | LCWSEAIMOHDXKM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron?
The IUPAC name of 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron (CID 173339522) is 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron.
What is the SMILES notation for 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron?
The canonical SMILES for 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron is Nc1ccc(O)c(Cl)c1Cl.O=S(=O)([O-])O.[H+].
What is the InChIKey of 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron?
The InChIKey is LCWSEAIMOHDXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2NO.H2O4S/c7-5-3(9)1-2-4(10)6(5)8;1-5(2,3)4/h1-2,10H,9H2;(H2,1,2,3,4).
What are the key properties of 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron?
4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron has a molecular weight of 276.10 g/mol, XLogP of 1.40, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dichlorophenol;hydrogen sulfate;hydron is sourced from PubChem (CID 173339522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).