About 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole
3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole (PubChem CID 173339595) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole.
Molecular Properties
| Compound Name | 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole |
| PubChem CID | 173339595 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole |
| SMILES | Cc1ccc2c(-c3ccnc(C(C)(C)C)n3)cn(C)c2c1 |
| InChI | InChI=1S/C18H21N3/c1-12-6-7-13-14(11-21(5)16(13)10-12)15-8-9-19-17(20-15)18(2,3)4/h6-11H,1-5H3 |
| InChIKey | FEHKRNJAHQQRDJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole?
The IUPAC name of 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole (CID 173339595) is 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole.
What is the SMILES notation for 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole?
The canonical SMILES for 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole is Cc1ccc2c(-c3ccnc(C(C)(C)C)n3)cn(C)c2c1.
What is the InChIKey of 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole?
The InChIKey is FEHKRNJAHQQRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3/c1-12-6-7-13-14(11-21(5)16(13)10-12)15-8-9-19-17(20-15)18(2,3)4/h6-11H,1-5H3.
What are the key properties of 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole?
3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole has a molecular weight of 279.39 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-tert-butylpyrimidin-4-yl)-1,6-dimethylindole is sourced from PubChem (CID 173339595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).