About tetrapotassium;hexa-2,4-dienoate;phosphate
tetrapotassium;hexa-2,4-dienoate;phosphate (PubChem CID 173339817) has the molecular formula C6H7K4O6P
and a molecular weight of 362.48 g/mol. Its IUPAC name is tetrapotassium;hexa-2,4-dienoate;phosphate.
Molecular Properties
| Compound Name | tetrapotassium;hexa-2,4-dienoate;phosphate |
| PubChem CID | 173339817 |
| Molecular Formula | C6H7K4O6P |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | tetrapotassium;hexa-2,4-dienoate;phosphate |
| SMILES | CC=CC=CC(=O)[O-].O=P([O-])([O-])[O-].[K+].[K+].[K+].[K+] |
| InChI | InChI=1S/C6H8O2.4K.H3O4P/c1-2-3-4-5-6(7)8;;;;;1-5(2,3)4/h2-5H,1H3,(H,7,8);;;;;(H3,1,2,3,4)/q;4*+1;/p-4 |
| InChIKey | VDIJSGNJNKGEIH-UHFFFAOYSA-J |
| XLogP | -14.94 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | -14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tetrapotassium;hexa-2,4-dienoate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapotassium;hexa-2,4-dienoate;phosphate?
The IUPAC name of tetrapotassium;hexa-2,4-dienoate;phosphate (CID 173339817) is tetrapotassium;hexa-2,4-dienoate;phosphate.
What is the SMILES notation for tetrapotassium;hexa-2,4-dienoate;phosphate?
The canonical SMILES for tetrapotassium;hexa-2,4-dienoate;phosphate is CC=CC=CC(=O)[O-].O=P([O-])([O-])[O-].[K+].[K+].[K+].[K+].
What is the InChIKey of tetrapotassium;hexa-2,4-dienoate;phosphate?
The InChIKey is VDIJSGNJNKGEIH-UHFFFAOYSA-J. The full InChI is InChI=1S/C6H8O2.4K.H3O4P/c1-2-3-4-5-6(7)8;;;;;1-5(2,3)4/h2-5H,1H3,(H,7,8);;;;;(H3,1,2,3,4)/q;4*+1;/p-4.
What are the key properties of tetrapotassium;hexa-2,4-dienoate;phosphate?
tetrapotassium;hexa-2,4-dienoate;phosphate has a molecular weight of 362.48 g/mol, XLogP of -14.94, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapotassium;hexa-2,4-dienoate;phosphate is sourced from PubChem (CID 173339817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).