C19H28 — CID 173340112
6-but-3-enyl-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (PubChem CID 173340112) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 6-but-3-enyl-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | 6-but-3-enyl-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 173340112 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 6-but-3-enyl-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
| SMILES | C=CCCc1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C19H28/c1-7-8-9-15-13-17-16(12-14(15)2)18(3,4)10-11-19(17,5)6/h7,12-13H,1,8-11H2,2-6H3 |
| InChIKey | HHAOUQNISGCANI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|