About N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride
N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride (PubChem CID 173340844) has the molecular formula C10H21ClN2O3
and a molecular weight of 252.74 g/mol. Its IUPAC name is N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride |
| PubChem CID | 173340844 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride |
| SMILES | C=CC(=O)NC(C)(C)CC(=O)O.CNC.Cl |
| InChI | InChI=1S/C8H13NO3.C2H7N.ClH/c1-4-6(10)9-8(2,3)5-7(11)12;1-3-2;/h4H,1,5H2,2-3H3,(H,9,10)(H,11,12);3H,1-2H3;1H |
| InChIKey | FNXKQLYYIRVQIV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride?
The IUPAC name of N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride (CID 173340844) is N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride.
What is the SMILES notation for N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride?
The canonical SMILES for N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride is C=CC(=O)NC(C)(C)CC(=O)O.CNC.Cl.
What is the InChIKey of N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride?
The InChIKey is FNXKQLYYIRVQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.C2H7N.ClH/c1-4-6(10)9-8(2,3)5-7(11)12;1-3-2;/h4H,1,5H2,2-3H3,(H,9,10)(H,11,12);3H,1-2H3;1H.
What are the key properties of N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride?
N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride has a molecular weight of 252.74 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;3-methyl-3-(prop-2-enoylamino)butanoic acid;hydrochloride is sourced from PubChem (CID 173340844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).