About azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid
azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid (PubChem CID 173341271) has the molecular formula C14H17NO6S
and a molecular weight of 327.36 g/mol. Its IUPAC name is azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid.
Molecular Properties
| Compound Name | azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid |
| PubChem CID | 173341271 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid |
| SMILES | COc1ccc(C(O)c2cc(S(=O)(=O)O)ccc2O)cc1.N |
| InChI | InChI=1S/C14H14O6S.H3N/c1-20-10-4-2-9(3-5-10)14(16)12-8-11(21(17,18)19)6-7-13(12)15;/h2-8,14-16H,1H3,(H,17,18,19);1H3 |
| InChIKey | RAGSHVGHMBYMEB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid?
The IUPAC name of azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid (CID 173341271) is azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid.
What is the SMILES notation for azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid?
The canonical SMILES for azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid is COc1ccc(C(O)c2cc(S(=O)(=O)O)ccc2O)cc1.N.
What is the InChIKey of azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid?
The InChIKey is RAGSHVGHMBYMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O6S.H3N/c1-20-10-4-2-9(3-5-10)14(16)12-8-11(21(17,18)19)6-7-13(12)15;/h2-8,14-16H,1H3,(H,17,18,19);1H3.
What are the key properties of azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid?
azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid has a molecular weight of 327.36 g/mol, XLogP of 1.89, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-hydroxy-3-[hydroxy-(4-methoxyphenyl)methyl]benzenesulfonic acid is sourced from PubChem (CID 173341271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).