About sodium;ethyl-tris(1H-inden-1-yl)silane;hydride
sodium;ethyl-tris(1H-inden-1-yl)silane;hydride (PubChem CID 173341376) has the molecular formula C29H27NaSi
and a molecular weight of 426.61 g/mol. Its IUPAC name is sodium;ethyl-tris(1H-inden-1-yl)silane;hydride.
Molecular Properties
| Compound Name | sodium;ethyl-tris(1H-inden-1-yl)silane;hydride |
| PubChem CID | 173341376 |
| Molecular Formula | C29H27NaSi |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | sodium;ethyl-tris(1H-inden-1-yl)silane;hydride |
| SMILES | CC[Si](C1C=Cc2ccccc21)(C1C=Cc2ccccc21)C1C=Cc2ccccc21.[H-].[Na+] |
| InChI | InChI=1S/C29H26Si.Na.H/c1-2-30(27-18-15-21-9-3-6-12-24(21)27,28-19-16-22-10-4-7-13-25(22)28)29-20-17-23-11-5-8-14-26(23)29;;/h3-20,27-29H,2H2,1H3;;/q;+1;-1 |
| InChIKey | XKEWUKPKSJZAJE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl-tris(1H-inden-1-yl)silane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl-tris(1H-inden-1-yl)silane;hydride?
The IUPAC name of sodium;ethyl-tris(1H-inden-1-yl)silane;hydride (CID 173341376) is sodium;ethyl-tris(1H-inden-1-yl)silane;hydride.
What is the SMILES notation for sodium;ethyl-tris(1H-inden-1-yl)silane;hydride?
The canonical SMILES for sodium;ethyl-tris(1H-inden-1-yl)silane;hydride is CC[Si](C1C=Cc2ccccc21)(C1C=Cc2ccccc21)C1C=Cc2ccccc21.[H-].[Na+].
What is the InChIKey of sodium;ethyl-tris(1H-inden-1-yl)silane;hydride?
The InChIKey is XKEWUKPKSJZAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26Si.Na.H/c1-2-30(27-18-15-21-9-3-6-12-24(21)27,28-19-16-22-10-4-7-13-25(22)28)29-20-17-23-11-5-8-14-26(23)29;;/h3-20,27-29H,2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;ethyl-tris(1H-inden-1-yl)silane;hydride?
sodium;ethyl-tris(1H-inden-1-yl)silane;hydride has a molecular weight of 426.61 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl-tris(1H-inden-1-yl)silane;hydride is sourced from PubChem (CID 173341376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).