About (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid
(E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid (PubChem CID 173341397) has the molecular formula C16H36O6Si4
and a molecular weight of 436.80 g/mol. Its IUPAC name is (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid.
Molecular Properties
| Compound Name | (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid |
| PubChem CID | 173341397 |
| Molecular Formula | C16H36O6Si4 |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid |
| SMILES | C[SiH2]O[Si](C)(C)C(C)(C)/C(C(=O)O)=C(\C(=O)O)C(C)(C)[Si](C)(C)O[SiH2]C |
| InChI | InChI=1S/C16H36O6Si4/c1-15(2,25(7,8)21-23-5)11(13(17)18)12(14(19)20)16(3,4)26(9,10)22-24-6/h23-24H2,1-10H3,(H,17,18)(H,19,20)/b12-11+ |
| InChIKey | GRFRNVOKUAJQFX-VAWYXSNFSA-N |
| XLogP | 2.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid?
The IUPAC name of (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid (CID 173341397) is (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid.
What is the SMILES notation for (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid?
The canonical SMILES for (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid is C[SiH2]O[Si](C)(C)C(C)(C)/C(C(=O)O)=C(\C(=O)O)C(C)(C)[Si](C)(C)O[SiH2]C.
What is the InChIKey of (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid?
The InChIKey is GRFRNVOKUAJQFX-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H36O6Si4/c1-15(2,25(7,8)21-23-5)11(13(17)18)12(14(19)20)16(3,4)26(9,10)22-24-6/h23-24H2,1-10H3,(H,17,18)(H,19,20)/b12-11+.
What are the key properties of (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid?
(E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid has a molecular weight of 436.80 g/mol, XLogP of 2.72, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis[2-[dimethyl(methylsilyloxy)silyl]propan-2-yl]but-2-enedioic acid is sourced from PubChem (CID 173341397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).