C9H15LiSi — CID 173341675
lithium;hydride;4,5,6,7-tetrahydro-1H-inden-1-ylsilane (PubChem CID 173341675) has the molecular formula C9H15LiSi and a molecular weight of 158.25 g/mol. Its IUPAC name is lithium;hydride;4,5,6,7-tetrahydro-1H-inden-1-ylsilane.
| Compound Name | lithium;hydride;4,5,6,7-tetrahydro-1H-inden-1-ylsilane |
|---|---|
| PubChem CID | 173341675 |
| Molecular Formula | C9H15LiSi |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | lithium;hydride;4,5,6,7-tetrahydro-1H-inden-1-ylsilane |
| SMILES | [H-].[Li+].[SiH3]C1C=CC2=C1CCCC2 |
| InChI | InChI=1S/C9H14Si.Li.H/c10-9-6-5-7-3-1-2-4-8(7)9;;/h5-6,9H,1-4H2,10H3;;/q;+1;-1 |
| InChIKey | NDNVHRIHKPQQFI-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|