About CID 173341726
CID 173341726 (PubChem CID 173341726) has the molecular formula C33H35ClN2O5
and a molecular weight of 575.11 g/mol.
Molecular Properties
| Compound Name | CID 173341726 |
| PubChem CID | 173341726 |
| Molecular Formula | C33H35ClN2O5 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(C(=CC=CC(O)(c2ccccc2)c2ccc(N(C)C)cc2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C33H34N2O.ClHO4/c1-34(2)30-21-17-27(18-22-30)32(26-12-7-5-8-13-26)16-11-25-33(36,28-14-9-6-10-15-28)29-19-23-31(24-20-29)35(3)4;2-1(3,4)5/h5-25,36H,1-4H3;(H,2,3,4,5) |
| InChIKey | XJOCZBIBUKCMKU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 173341726 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173341726?
The IUPAC name of CID 173341726 (CID 173341726) is not available.
What is the SMILES notation for CID 173341726?
The canonical SMILES for CID 173341726 is CN(C)c1ccc(C(=CC=CC(O)(c2ccccc2)c2ccc(N(C)C)cc2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of CID 173341726?
The InChIKey is XJOCZBIBUKCMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34N2O.ClHO4/c1-34(2)30-21-17-27(18-22-30)32(26-12-7-5-8-13-26)16-11-25-33(36,28-14-9-6-10-15-28)29-19-23-31(24-20-29)35(3)4;2-1(3,4)5/h5-25,36H,1-4H3;(H,2,3,4,5).
What are the key properties of CID 173341726?
CID 173341726 has a molecular weight of 575.11 g/mol, XLogP of 2.62, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173341726 is sourced from PubChem (CID 173341726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).