C33H49BrN2O2S — CID 173343512
2-(3-tert-butyl-4-decoxyphenyl)-N-[3-[(4-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]acetamide;hydrobromide (PubChem CID 173343512) has the molecular formula C33H49BrN2O2S and a molecular weight of 617.74 g/mol. Its IUPAC name is 2-(3-tert-butyl-4-decoxyphenyl)-N-[3-[(4-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]acetamide;hydrobromide.
| Compound Name | 2-(3-tert-butyl-4-decoxyphenyl)-N-[3-[(4-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]acetamide;hydrobromide |
|---|---|
| PubChem CID | 173343512 |
| Molecular Formula | C33H49BrN2O2S |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 2-(3-tert-butyl-4-decoxyphenyl)-N-[3-[(4-methyl-2H-1,3-thiazol-3-yl)methyl]phenyl]acetamide;hydrobromide |
| SMILES | Br.CCCCCCCCCCOc1ccc(CC(=O)Nc2cccc(CN3CSC=C3C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C33H48N2O2S.BrH/c1-6-7-8-9-10-11-12-13-19-37-31-18-17-27(21-30(31)33(3,4)5)22-32(36)34-29-16-14-15-28(20-29)23-35-25-38-24-26(35)2;/h14-18,20-21,24H,6-13,19,22-23,25H2,1-5H3,(H,34,36);1H |
| InChIKey | VFEMRFLNTLGVNI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|