C27H32S — CID 173343751
3-[3-(7,13,13-trimethyltetradeca-1,6,9-trien-11-ynyl)phenyl]thiophene (PubChem CID 173343751) has the molecular formula C27H32S and a molecular weight of 388.62 g/mol. Its IUPAC name is 3-[3-(7,13,13-trimethyltetradeca-1,6,9-trien-11-ynyl)phenyl]thiophene.
| Compound Name | 3-[3-(7,13,13-trimethyltetradeca-1,6,9-trien-11-ynyl)phenyl]thiophene |
|---|---|
| PubChem CID | 173343751 |
| Molecular Formula | C27H32S |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-[3-(7,13,13-trimethyltetradeca-1,6,9-trien-11-ynyl)phenyl]thiophene |
| SMILES | CC(=CCCCC=Cc1cccc(-c2ccsc2)c1)CC=CC#CC(C)(C)C |
| InChI | InChI=1S/C27H32S/c1-23(14-9-7-11-19-27(2,3)4)13-8-5-6-10-15-24-16-12-17-25(21-24)26-18-20-28-22-26/h7,9-10,12-13,15-18,20-22H,5-6,8,14H2,1-4H3 |
| InChIKey | JDNRDPMSWDPCHW-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|