About potassium;6-chloropyridine-2-sulfonic acid;hydride
potassium;6-chloropyridine-2-sulfonic acid;hydride (PubChem CID 173343917) has the molecular formula C5H5ClKNO3S
and a molecular weight of 233.72 g/mol. Its IUPAC name is potassium;6-chloropyridine-2-sulfonic acid;hydride.
Molecular Properties
| Compound Name | potassium;6-chloropyridine-2-sulfonic acid;hydride |
| PubChem CID | 173343917 |
| Molecular Formula | C5H5ClKNO3S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | potassium;6-chloropyridine-2-sulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1cccc(Cl)n1.[H-].[K+] |
| InChI | InChI=1S/C5H4ClNO3S.K.H/c6-4-2-1-3-5(7-4)11(8,9)10;;/h1-3H,(H,8,9,10);;/q;+1;-1 |
| InChIKey | LXGLSMACYSBIIL-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;6-chloropyridine-2-sulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;6-chloropyridine-2-sulfonic acid;hydride?
The IUPAC name of potassium;6-chloropyridine-2-sulfonic acid;hydride (CID 173343917) is potassium;6-chloropyridine-2-sulfonic acid;hydride.
What is the SMILES notation for potassium;6-chloropyridine-2-sulfonic acid;hydride?
The canonical SMILES for potassium;6-chloropyridine-2-sulfonic acid;hydride is O=S(=O)(O)c1cccc(Cl)n1.[H-].[K+].
What is the InChIKey of potassium;6-chloropyridine-2-sulfonic acid;hydride?
The InChIKey is LXGLSMACYSBIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO3S.K.H/c6-4-2-1-3-5(7-4)11(8,9)10;;/h1-3H,(H,8,9,10);;/q;+1;-1.
What are the key properties of potassium;6-chloropyridine-2-sulfonic acid;hydride?
potassium;6-chloropyridine-2-sulfonic acid;hydride has a molecular weight of 233.72 g/mol, XLogP of -1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;6-chloropyridine-2-sulfonic acid;hydride is sourced from PubChem (CID 173343917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).