About sodium;hydride;10H-phenothiazine-2-sulfonic acid
sodium;hydride;10H-phenothiazine-2-sulfonic acid (PubChem CID 173344375) has the molecular formula C12H10NNaO3S2
and a molecular weight of 303.34 g/mol. Its IUPAC name is sodium;hydride;10H-phenothiazine-2-sulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;10H-phenothiazine-2-sulfonic acid |
| PubChem CID | 173344375 |
| Molecular Formula | C12H10NNaO3S2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | sodium;hydride;10H-phenothiazine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)Nc1ccccc1S2.[H-].[Na+] |
| InChI | InChI=1S/C12H9NO3S2.Na.H/c14-18(15,16)8-5-6-12-10(7-8)13-9-3-1-2-4-11(9)17-12;;/h1-7,13H,(H,14,15,16);;/q;+1;-1 |
| InChIKey | PVDLEYROJKVXNG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;10H-phenothiazine-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;10H-phenothiazine-2-sulfonic acid?
The IUPAC name of sodium;hydride;10H-phenothiazine-2-sulfonic acid (CID 173344375) is sodium;hydride;10H-phenothiazine-2-sulfonic acid.
What is the SMILES notation for sodium;hydride;10H-phenothiazine-2-sulfonic acid?
The canonical SMILES for sodium;hydride;10H-phenothiazine-2-sulfonic acid is O=S(=O)(O)c1ccc2c(c1)Nc1ccccc1S2.[H-].[Na+].
What is the InChIKey of sodium;hydride;10H-phenothiazine-2-sulfonic acid?
The InChIKey is PVDLEYROJKVXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3S2.Na.H/c14-18(15,16)8-5-6-12-10(7-8)13-9-3-1-2-4-11(9)17-12;;/h1-7,13H,(H,14,15,16);;/q;+1;-1.
What are the key properties of sodium;hydride;10H-phenothiazine-2-sulfonic acid?
sodium;hydride;10H-phenothiazine-2-sulfonic acid has a molecular weight of 303.34 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;10H-phenothiazine-2-sulfonic acid is sourced from PubChem (CID 173344375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).