C7ClF11 — CID 173344552
1-chloro-1,2,3,4,5,5,6,6,7,7,7-undecafluorohepta-1,3-diene (PubChem CID 173344552) has the molecular formula C7ClF11 and a molecular weight of 328.51 g/mol. Its IUPAC name is 1-chloro-1,2,3,4,5,5,6,6,7,7,7-undecafluorohepta-1,3-diene.
| Compound Name | 1-chloro-1,2,3,4,5,5,6,6,7,7,7-undecafluorohepta-1,3-diene |
|---|---|
| PubChem CID | 173344552 |
| Molecular Formula | C7ClF11 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 1-chloro-1,2,3,4,5,5,6,6,7,7,7-undecafluorohepta-1,3-diene |
| SMILES | FC(Cl)=C(F)C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7ClF11/c8-4(12)2(10)1(9)3(11)5(13,14)6(15,16)7(17,18)19 |
| InChIKey | UBPRHQOXAQRCCT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|