About 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol
4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 173344642) has the molecular formula C14H12ClNO3
and a molecular weight of 277.71 g/mol. Its IUPAC name is 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol |
| PubChem CID | 173344642 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | O=[N+]([O-])C1(O)C=CC(C(Cl)=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H12ClNO3/c15-13(10-11-4-2-1-3-5-11)12-6-8-14(17,9-7-12)16(18)19/h1-8,10,17H,9H2 |
| InChIKey | BXDQXEMRPIFENS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol (CID 173344642) is 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol is O=[N+]([O-])C1(O)C=CC(C(Cl)=Cc2ccccc2)=CC1.
What is the InChIKey of 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol?
The InChIKey is BXDQXEMRPIFENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO3/c15-13(10-11-4-2-1-3-5-11)12-6-8-14(17,9-7-12)16(18)19/h1-8,10,17H,9H2.
What are the key properties of 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol?
4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol has a molecular weight of 277.71 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloro-2-phenylethenyl)-1-nitrocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 173344642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).