C25H42N2O6Si — CID 173344672
prop-2-enyl (2S,4R)-2-[(E)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 173344672) has the molecular formula C25H42N2O6Si and a molecular weight of 494.71 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-2-[(E)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-2-[(E)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173344672 |
| Molecular Formula | C25H42N2O6Si |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | prop-2-enyl (2S,4R)-2-[(E)-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OC)C[C@H]1/C=C(\C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C25H42N2O6Si/c1-10-11-32-23(30)27-15-18(31-7)13-17(27)12-16(2)20(28)14-19-21(22(29)26-19)25(6,24(3,4)5)33-34(8)9/h10,12,17-19,21,34H,1,11,13-15H2,2-9H3,(H,26,29)/b16-12+/t17-,18-,19-,21-,25-/m1/s1 |
| InChIKey | UPWVZSGXFQTNRT-LDWPFMHTSA-N |
| XLogP | 3.22 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|