About oxido(dioxo)tungsten;phosphoric acid;thallium(1+)
oxido(dioxo)tungsten;phosphoric acid;thallium(1+) (PubChem CID 173344758) has the molecular formula H3O7PTlW
and a molecular weight of 534.21 g/mol. Its IUPAC name is oxido(dioxo)tungsten;phosphoric acid;thallium(1+).
Molecular Properties
| Compound Name | oxido(dioxo)tungsten;phosphoric acid;thallium(1+) |
| PubChem CID | 173344758 |
| Molecular Formula | H3O7PTlW |
| Molecular Weight | 534.21 g/mol |
| Exact Mass | 534.89 |
| IUPAC Name | oxido(dioxo)tungsten;phosphoric acid;thallium(1+) |
| SMILES | O=P(O)(O)O.O=[W](=O)[O-].[Tl+] |
| InChI | InChI=1S/H3O4P.3O.Tl.W/c1-5(2,3)4;;;;;/h(H3,1,2,3,4);;;;;/q;;;-1;+1; |
| InChIKey | GOAJVOFCGPGWTJ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.21 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxido(dioxo)tungsten;phosphoric acid;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido(dioxo)tungsten;phosphoric acid;thallium(1+)?
The IUPAC name of oxido(dioxo)tungsten;phosphoric acid;thallium(1+) (CID 173344758) is oxido(dioxo)tungsten;phosphoric acid;thallium(1+).
What is the SMILES notation for oxido(dioxo)tungsten;phosphoric acid;thallium(1+)?
The canonical SMILES for oxido(dioxo)tungsten;phosphoric acid;thallium(1+) is O=P(O)(O)O.O=[W](=O)[O-].[Tl+].
What is the InChIKey of oxido(dioxo)tungsten;phosphoric acid;thallium(1+)?
The InChIKey is GOAJVOFCGPGWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O4P.3O.Tl.W/c1-5(2,3)4;;;;;/h(H3,1,2,3,4);;;;;/q;;;-1;+1;.
What are the key properties of oxido(dioxo)tungsten;phosphoric acid;thallium(1+)?
oxido(dioxo)tungsten;phosphoric acid;thallium(1+) has a molecular weight of 534.21 g/mol, XLogP of -2.74, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxido(dioxo)tungsten;phosphoric acid;thallium(1+) is sourced from PubChem (CID 173344758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).