About sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride
sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride (PubChem CID 173344787) has the molecular formula C19H41Cl2NaO6P2
and a molecular weight of 521.38 g/mol. Its IUPAC name is sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride.
Molecular Properties
| Compound Name | sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride |
| PubChem CID | 173344787 |
| Molecular Formula | C19H41Cl2NaO6P2 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride |
| SMILES | CCCCCCOP(=O)(O)C(Cl)(Cl)P(=O)(OCCCCCC)OCCCCCC.[H-].[Na+] |
| InChI | InChI=1S/C19H40Cl2O6P2.Na.H/c1-4-7-10-13-16-25-28(22,23)19(20,21)29(24,26-17-14-11-8-5-2)27-18-15-12-9-6-3;;/h4-18H2,1-3H3,(H,22,23);;/q;+1;-1 |
| InChIKey | UNBRYHCWYRBOKR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride?
The IUPAC name of sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride (CID 173344787) is sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride.
What is the SMILES notation for sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride?
The canonical SMILES for sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride is CCCCCCOP(=O)(O)C(Cl)(Cl)P(=O)(OCCCCCC)OCCCCCC.[H-].[Na+].
What is the InChIKey of sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride?
The InChIKey is UNBRYHCWYRBOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40Cl2O6P2.Na.H/c1-4-7-10-13-16-25-28(22,23)19(20,21)29(24,26-17-14-11-8-5-2)27-18-15-12-9-6-3;;/h4-18H2,1-3H3,(H,22,23);;/q;+1;-1.
What are the key properties of sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride?
sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride has a molecular weight of 521.38 g/mol, XLogP of 5.36, 20 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;[dichloro(dihexoxyphosphoryl)methyl]-hexoxyphosphinic acid;hydride is sourced from PubChem (CID 173344787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).