C20H38O6Si — CID 173345029
4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-7-(1-ethoxyethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one (PubChem CID 173345029) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is 4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-7-(1-ethoxyethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | 4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-7-(1-ethoxyethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 173345029 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-7-(1-ethoxyethoxy)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CCOC(C)OC1CC(=O)C(C(O[SiH](C)C)C(C)(C)C)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C20H38O6Si/c1-10-22-12(2)23-14-11-13(21)15(17-16(14)24-20(6,7)25-17)18(19(3,4)5)26-27(8)9/h12,14-18,27H,10-11H2,1-9H3 |
| InChIKey | YQPFCIDDQLXEQZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|