C36H28N5O7S+ — CID 173345279
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-[4-(2-methyl-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl)phenoxy]ethyl]thiourea (PubChem CID 173345279) has the molecular formula C36H28N5O7S+ and a molecular weight of 674.72 g/mol. Its IUPAC name is 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-[4-(2-methyl-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl)phenoxy]ethyl]thiourea.
| Compound Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-[4-(2-methyl-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl)phenoxy]ethyl]thiourea |
|---|---|
| PubChem CID | 173345279 |
| Molecular Formula | C36H28N5O7S+ |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-[4-(2-methyl-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl)phenoxy]ethyl]thiourea |
| SMILES | CC1Nc2cnc(-c3ccc(OCCNC(=S)Nc4ccc5c(c4)C(=O)OC54c5ccc(O)cc5Oc5cc(O)ccc54)cc3)c[n+]2C1=O |
| InChI | InChI=1S/C36H27N5O7S/c1-19-33(44)41-18-29(38-17-32(41)39-19)20-2-7-24(8-3-20)46-13-12-37-35(49)40-21-4-9-26-25(14-21)34(45)48-36(26)27-10-5-22(42)15-30(27)47-31-16-23(43)6-11-28(31)36/h2-11,14-19H,12-13H2,1H3,(H4,37,40,42,43,49)/p+1 |
| InChIKey | YWMPIVNVAVPFAD-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|