C24H30O3Si — CID 173345544
(3aR,4S,6aS)-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 173345544) has the molecular formula C24H30O3Si and a molecular weight of 394.59 g/mol. Its IUPAC name is (3aR,4S,6aS)-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,6aS)-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 173345544 |
| Molecular Formula | C24H30O3Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3aR,4S,6aS)-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)[C@H]1CC[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C24H30O3Si/c1-24(2,3)23(19-14-15-21-20(19)16-22(25)26-21)27-28(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-21,23,28H,14-16H2,1-3H3/t19-,20+,21-,23?/m0/s1 |
| InChIKey | ZCRYUWJYMHNBNL-XXJJDXCVSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|