About dioxolead;iron;sulfuric acid
dioxolead;iron;sulfuric acid (PubChem CID 173345892) has the molecular formula H2FeO6PbS
and a molecular weight of 393.12 g/mol. Its IUPAC name is dioxolead;iron;sulfuric acid.
Molecular Properties
| Compound Name | dioxolead;iron;sulfuric acid |
| PubChem CID | 173345892 |
| Molecular Formula | H2FeO6PbS |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | dioxolead;iron;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[Pb]=O.[Fe] |
| InChI | InChI=1S/Fe.H2O4S.2O.Pb/c;1-5(2,3)4;;;/h;(H2,1,2,3,4);;; |
| InChIKey | WDBOGGMDXOWSJY-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dioxolead;iron;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxolead;iron;sulfuric acid?
The IUPAC name of dioxolead;iron;sulfuric acid (CID 173345892) is dioxolead;iron;sulfuric acid.
What is the SMILES notation for dioxolead;iron;sulfuric acid?
The canonical SMILES for dioxolead;iron;sulfuric acid is O=S(=O)(O)O.O=[Pb]=O.[Fe].
What is the InChIKey of dioxolead;iron;sulfuric acid?
The InChIKey is WDBOGGMDXOWSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/Fe.H2O4S.2O.Pb/c;1-5(2,3)4;;;/h;(H2,1,2,3,4);;;.
What are the key properties of dioxolead;iron;sulfuric acid?
dioxolead;iron;sulfuric acid has a molecular weight of 393.12 g/mol, XLogP of -1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxolead;iron;sulfuric acid is sourced from PubChem (CID 173345892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).