C33H45N5O7 — CID 173345929
benzyl (2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]piperidine-1-carbonyl]amino]-3-phenylpropanoate (PubChem CID 173345929) has the molecular formula C33H45N5O7 and a molecular weight of 623.75 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]piperidine-1-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]piperidine-1-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 173345929 |
| Molecular Formula | C33H45N5O7 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.33 |
| IUPAC Name | benzyl (2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]piperidine-1-carbonyl]amino]-3-phenylpropanoate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H45N5O7/c1-32(2,3)44-30(41)36-28(34)38(31(42)45-33(4,5)6)25-17-19-37(20-18-25)29(40)35-26(21-23-13-9-7-10-14-23)27(39)43-22-24-15-11-8-12-16-24/h7-16,25-26H,17-22H2,1-6H3,(H,35,40)(H2,34,36,41)/t26-/m0/s1 |
| InChIKey | GTCFEHBMTWGEEK-SANMLTNESA-N |
| XLogP | 5.21 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|