C18H30 — CID 173346096
6,15-dimethylhexadeca-1,6,9,14-tetraene (PubChem CID 173346096) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 6,15-dimethylhexadeca-1,6,9,14-tetraene.
| Compound Name | 6,15-dimethylhexadeca-1,6,9,14-tetraene |
|---|---|
| PubChem CID | 173346096 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 6,15-dimethylhexadeca-1,6,9,14-tetraene |
| SMILES | C=CCCCC(C)=CCC=CCCCC=C(C)C |
| InChI | InChI=1S/C18H30/c1-5-6-11-15-18(4)16-13-10-8-7-9-12-14-17(2)3/h5,8,10,14,16H,1,6-7,9,11-13,15H2,2-4H3 |
| InChIKey | OIOLGSSLNNQORY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|