C6H8O6 — CID 173346347
(4S,5R)-4,5,6-trihydroxy-2-(hydroxymethylidene)oxan-3-one (PubChem CID 173346347) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is (4S,5R)-4,5,6-trihydroxy-2-(hydroxymethylidene)oxan-3-one.
| Compound Name | (4S,5R)-4,5,6-trihydroxy-2-(hydroxymethylidene)oxan-3-one |
|---|---|
| PubChem CID | 173346347 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (4S,5R)-4,5,6-trihydroxy-2-(hydroxymethylidene)oxan-3-one |
| SMILES | O=C1C(=CO)OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h1,4-7,9-11H/t4-,5-,6?/m1/s1 |
| InChIKey | QDTHACSMCQIYAI-QYRBDRAASA-N |
| XLogP | -1.97 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|