C11H13F13OSi — CID 173346529
(3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoro-2-methyldecan-2-yl)oxysilane (PubChem CID 173346529) has the molecular formula C11H13F13OSi and a molecular weight of 436.28 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoro-2-methyldecan-2-yl)oxysilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoro-2-methyldecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 173346529 |
| Molecular Formula | C11H13F13OSi |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoro-2-methyldecan-2-yl)oxysilane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(C)O[SiH3] |
| InChI | InChI=1S/C11H13F13OSi/c1-4(12)6(13,14)8(17,18)10(21,22)11(23,24)9(19,20)7(15,16)5(2,3)25-26/h4H,1-3,26H3 |
| InChIKey | UVEWMKPPSVMCNN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|