About alumane;sulfuric acid;urea
alumane;sulfuric acid;urea (PubChem CID 173346589) has the molecular formula CH9AlN2O5S
and a molecular weight of 188.14 g/mol. Its IUPAC name is alumane;sulfuric acid;urea.
Molecular Properties
| Compound Name | alumane;sulfuric acid;urea |
| PubChem CID | 173346589 |
| Molecular Formula | CH9AlN2O5S |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | alumane;sulfuric acid;urea |
| SMILES | NC(N)=O.O=S(=O)(O)O.[AlH3] |
| InChI | InChI=1S/CH4N2O.Al.H2O4S.3H/c2-1(3)4;;1-5(2,3)4;;;/h(H4,2,3,4);;(H2,1,2,3,4);;; |
| InChIKey | FQRMVRXJLLXEJN-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze alumane;sulfuric acid;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;sulfuric acid;urea?
The IUPAC name of alumane;sulfuric acid;urea (CID 173346589) is alumane;sulfuric acid;urea.
What is the SMILES notation for alumane;sulfuric acid;urea?
The canonical SMILES for alumane;sulfuric acid;urea is NC(N)=O.O=S(=O)(O)O.[AlH3].
What is the InChIKey of alumane;sulfuric acid;urea?
The InChIKey is FQRMVRXJLLXEJN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.Al.H2O4S.3H/c2-1(3)4;;1-5(2,3)4;;;/h(H4,2,3,4);;(H2,1,2,3,4);;;.
What are the key properties of alumane;sulfuric acid;urea?
alumane;sulfuric acid;urea has a molecular weight of 188.14 g/mol, XLogP of -2.81, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;sulfuric acid;urea is sourced from PubChem (CID 173346589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).