About silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane
silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane (PubChem CID 173346968) has the molecular formula C6H13F3OSi2
and a molecular weight of 214.33 g/mol. Its IUPAC name is silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane.
Molecular Properties
| Compound Name | silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane |
| PubChem CID | 173346968 |
| Molecular Formula | C6H13F3OSi2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane |
| SMILES | C=CCC(CC(F)(F)F)[SiH2]O[SiH3] |
| InChI | InChI=1S/C6H13F3OSi2/c1-2-3-5(12-10-11)4-6(7,8)9/h2,5H,1,3-4,12H2,11H3 |
| InChIKey | PBBOHGWLPQHTDP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane?
The IUPAC name of silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane (CID 173346968) is silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane.
What is the SMILES notation for silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane?
The canonical SMILES for silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane is C=CCC(CC(F)(F)F)[SiH2]O[SiH3].
What is the InChIKey of silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane?
The InChIKey is PBBOHGWLPQHTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3OSi2/c1-2-3-5(12-10-11)4-6(7,8)9/h2,5H,1,3-4,12H2,11H3.
What are the key properties of silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane?
silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane has a molecular weight of 214.33 g/mol, XLogP of 0.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silyloxy(1,1,1-trifluorohex-5-en-3-yl)silane is sourced from PubChem (CID 173346968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).